C14H12N2O2 — CID 47034241
N-(furan-3-ylmethyl)-1H-indole-2-carboxamide (PubChem CID 47034241) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-1H-indole-2-carboxamide.
| Compound Name | N-(furan-3-ylmethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 47034241 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | N-(furan-3-ylmethyl)-1H-indole-2-carboxamide |
| SMILES | O=C(NCc1ccoc1)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H12N2O2/c17-14(15-8-10-5-6-18-9-10)13-7-11-3-1-2-4-12(11)16-13/h1-7,9,16H,8H2,(H,15,17) |
| InChIKey | YYQKFVWVILDLQF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |