C19H14N2O3S — CID 90613186
N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]-1H-indole-2-carboxamide (PubChem CID 90613186) has the molecular formula C19H14N2O3S and a molecular weight of 350.40 g/mol. Its IUPAC name is N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]-1H-indole-2-carboxamide.
| Compound Name | N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 90613186 |
| Molecular Formula | C19H14N2O3S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NCc1ccc(C(=O)c2ccco2)s1)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H14N2O3S/c22-18(16-6-3-9-24-16)17-8-7-13(25-17)11-20-19(23)15-10-12-4-1-2-5-14(12)21-15/h1-10,21H,11H2,(H,20,23) |
| InChIKey | AHAFVXNMOVLBFI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |