C19H14N2O2S2 — CID 90613208
N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]-1H-indole-2-carboxamide (PubChem CID 90613208) has the molecular formula C19H14N2O2S2 and a molecular weight of 366.47 g/mol. Its IUPAC name is N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]-1H-indole-2-carboxamide.
| Compound Name | N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 90613208 |
| Molecular Formula | C19H14N2O2S2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NCc1ccc(C(=O)c2ccsc2)s1)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H14N2O2S2/c22-18(13-7-8-24-11-13)17-6-5-14(25-17)10-20-19(23)16-9-12-3-1-2-4-15(12)21-16/h1-9,11,21H,10H2,(H,20,23) |
| InChIKey | LOLAANBJVUKPBT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |