C17H11BrClNO2S2 — CID 90612616
5-bromo-2-chloro-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]benzamide (PubChem CID 90612616) has the molecular formula C17H11BrClNO2S2 and a molecular weight of 440.77 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 90612616 |
| Molecular Formula | C17H11BrClNO2S2 |
| Molecular Weight | 440.77 g/mol |
| Exact Mass | 438.91 |
| IUPAC Name | 5-bromo-2-chloro-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]benzamide |
| SMILES | O=C(c1ccsc1)c1ccc(CNC(=O)c2cc(Br)ccc2Cl)s1 |
| InChI | InChI=1S/C17H11BrClNO2S2/c18-11-1-3-14(19)13(7-11)17(22)20-8-12-2-4-15(24-12)16(21)10-5-6-23-9-10/h1-7,9H,8H2,(H,20,22) |
| InChIKey | ZKQVRHNVXLLQIS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.77 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |