C18H15NO2S2 — CID 90612500
4-methyl-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]benzamide (PubChem CID 90612500) has the molecular formula C18H15NO2S2 and a molecular weight of 341.46 g/mol. Its IUPAC name is 4-methyl-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]benzamide.
| Compound Name | 4-methyl-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 90612500 |
| Molecular Formula | C18H15NO2S2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 4-methyl-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCc2ccc(C(=O)c3ccsc3)s2)cc1 |
| InChI | InChI=1S/C18H15NO2S2/c1-12-2-4-13(5-3-12)18(21)19-10-15-6-7-16(23-15)17(20)14-8-9-22-11-14/h2-9,11H,10H2,1H3,(H,19,21) |
| InChIKey | INGPKTUNSWPVHT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |