C15H10BrNO2S3 — CID 72717695
4-bromo-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]thiophene-2-carboxamide (PubChem CID 72717695) has the molecular formula C15H10BrNO2S3 and a molecular weight of 412.36 g/mol. Its IUPAC name is 4-bromo-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]thiophene-2-carboxamide.
| Compound Name | 4-bromo-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 72717695 |
| Molecular Formula | C15H10BrNO2S3 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 410.91 |
| IUPAC Name | 4-bromo-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]thiophene-2-carboxamide |
| SMILES | O=C(NCc1ccc(C(=O)c2ccsc2)s1)c1cc(Br)cs1 |
| InChI | InChI=1S/C15H10BrNO2S3/c16-10-5-13(21-8-10)15(19)17-6-11-1-2-12(22-11)14(18)9-3-4-20-7-9/h1-5,7-8H,6H2,(H,17,19) |
| InChIKey | MWKHZLSDIWHRLU-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |