C18H12F3NO3S2 — CID 72717594
N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]-4-(trifluoromethoxy)benzamide (PubChem CID 72717594) has the molecular formula C18H12F3NO3S2 and a molecular weight of 411.43 g/mol. Its IUPAC name is N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 72717594 |
| Molecular Formula | C18H12F3NO3S2 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.02 |
| IUPAC Name | N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]-4-(trifluoromethoxy)benzamide |
| SMILES | O=C(NCc1ccc(C(=O)c2ccsc2)s1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H12F3NO3S2/c19-18(20,21)25-13-3-1-11(2-4-13)17(24)22-9-14-5-6-15(27-14)16(23)12-7-8-26-10-12/h1-8,10H,9H2,(H,22,24) |
| InChIKey | XPBVMXWFWKQFBS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |