C18H12N2O2S2 — CID 90612509
4-cyano-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]benzamide (PubChem CID 90612509) has the molecular formula C18H12N2O2S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 4-cyano-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]benzamide.
| Compound Name | 4-cyano-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 90612509 |
| Molecular Formula | C18H12N2O2S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 4-cyano-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]benzamide |
| SMILES | N#Cc1ccc(C(=O)NCc2ccc(C(=O)c3ccsc3)s2)cc1 |
| InChI | InChI=1S/C18H12N2O2S2/c19-9-12-1-3-13(4-2-12)18(22)20-10-15-5-6-16(24-15)17(21)14-7-8-23-11-14/h1-8,11H,10H2,(H,20,22) |
| InChIKey | YVIOKWGCGPEZLC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |