C14H13NO4S2 — CID 90612492
ethyl 2-oxo-2-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methylamino]acetate (PubChem CID 90612492) has the molecular formula C14H13NO4S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is ethyl 2-oxo-2-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methylamino]acetate.
| Compound Name | ethyl 2-oxo-2-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methylamino]acetate |
|---|---|
| PubChem CID | 90612492 |
| Molecular Formula | C14H13NO4S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | ethyl 2-oxo-2-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methylamino]acetate |
| SMILES | CCOC(=O)C(=O)NCc1ccc(C(=O)c2ccsc2)s1 |
| InChI | InChI=1S/C14H13NO4S2/c1-2-19-14(18)13(17)15-7-10-3-4-11(21-10)12(16)9-5-6-20-8-9/h3-6,8H,2,7H2,1H3,(H,15,17) |
| InChIKey | JHRQVNKMUVSQLE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|