C19H15ClN2O3S2 — CID 90612780
N-[(2-chlorophenyl)methyl]-N'-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]oxamide (PubChem CID 90612780) has the molecular formula C19H15ClN2O3S2 and a molecular weight of 418.93 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N'-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]oxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-N'-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 90612780 |
| Molecular Formula | C19H15ClN2O3S2 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N'-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]oxamide |
| SMILES | O=C(NCc1ccc(C(=O)c2ccsc2)s1)C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C19H15ClN2O3S2/c20-15-4-2-1-3-12(15)9-21-18(24)19(25)22-10-14-5-6-16(27-14)17(23)13-7-8-26-11-13/h1-8,11H,9-10H2,(H,21,24)(H,22,25) |
| InChIKey | BLNUAKOHGGHCRH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|