C18H13ClFNO2S2 — CID 72717694
2-(2-chloro-6-fluorophenyl)-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]acetamide (PubChem CID 72717694) has the molecular formula C18H13ClFNO2S2 and a molecular weight of 393.89 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 72717694 |
| Molecular Formula | C18H13ClFNO2S2 |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]acetamide |
| SMILES | O=C(Cc1c(F)cccc1Cl)NCc1ccc(C(=O)c2ccsc2)s1 |
| InChI | InChI=1S/C18H13ClFNO2S2/c19-14-2-1-3-15(20)13(14)8-17(22)21-9-12-4-5-16(25-12)18(23)11-6-7-24-10-11/h1-7,10H,8-9H2,(H,21,22) |
| InChIKey | PLQDWUGFLVMWIU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |