C18H13ClN2O3S2 — CID 90612759
N'-(4-chlorophenyl)-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]oxamide (PubChem CID 90612759) has the molecular formula C18H13ClN2O3S2 and a molecular weight of 404.90 g/mol. Its IUPAC name is N'-(4-chlorophenyl)-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]oxamide.
| Compound Name | N'-(4-chlorophenyl)-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 90612759 |
| Molecular Formula | C18H13ClN2O3S2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | N'-(4-chlorophenyl)-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]oxamide |
| SMILES | O=C(NCc1ccc(C(=O)c2ccsc2)s1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H13ClN2O3S2/c19-12-1-3-13(4-2-12)21-18(24)17(23)20-9-14-5-6-15(26-14)16(22)11-7-8-25-10-11/h1-8,10H,9H2,(H,20,23)(H,21,24) |
| InChIKey | YDSRTNHJOCSPDU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|