C20H18N2O3S2 — CID 90612754
N'-(2,5-dimethylphenyl)-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]oxamide (PubChem CID 90612754) has the molecular formula C20H18N2O3S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is N'-(2,5-dimethylphenyl)-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]oxamide.
| Compound Name | N'-(2,5-dimethylphenyl)-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 90612754 |
| Molecular Formula | C20H18N2O3S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | N'-(2,5-dimethylphenyl)-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]oxamide |
| SMILES | Cc1ccc(C)c(NC(=O)C(=O)NCc2ccc(C(=O)c3ccsc3)s2)c1 |
| InChI | InChI=1S/C20H18N2O3S2/c1-12-3-4-13(2)16(9-12)22-20(25)19(24)21-10-15-5-6-17(27-15)18(23)14-7-8-26-11-14/h3-9,11H,10H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | SZDRNCFHRVUAKZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|