C19H17NO2S2 — CID 90612512
3-phenyl-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]propanamide (PubChem CID 90612512) has the molecular formula C19H17NO2S2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 3-phenyl-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]propanamide.
| Compound Name | 3-phenyl-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 90612512 |
| Molecular Formula | C19H17NO2S2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 3-phenyl-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]propanamide |
| SMILES | O=C(CCc1ccccc1)NCc1ccc(C(=O)c2ccsc2)s1 |
| InChI | InChI=1S/C19H17NO2S2/c21-18(9-6-14-4-2-1-3-5-14)20-12-16-7-8-17(24-16)19(22)15-10-11-23-13-15/h1-5,7-8,10-11,13H,6,9,12H2,(H,20,21) |
| InChIKey | NBOLQDGUSMWYSM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |