C13H15NO3S3 — CID 90612640
N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]propane-1-sulfonamide (PubChem CID 90612640) has the molecular formula C13H15NO3S3 and a molecular weight of 329.47 g/mol. Its IUPAC name is N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]propane-1-sulfonamide.
| Compound Name | N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 90612640 |
| Molecular Formula | C13H15NO3S3 |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NCc1ccc(C(=O)c2ccsc2)s1 |
| InChI | InChI=1S/C13H15NO3S3/c1-2-7-20(16,17)14-8-11-3-4-12(19-11)13(15)10-5-6-18-9-10/h3-6,9,14H,2,7-8H2,1H3 |
| InChIKey | UNVQLTMKNWIUEP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |