C20H20N2O4S3 — CID 90612721
N-[3-methyl-4-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methylsulfamoyl]phenyl]propanamide (PubChem CID 90612721) has the molecular formula C20H20N2O4S3 and a molecular weight of 448.59 g/mol. Its IUPAC name is N-[3-methyl-4-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methylsulfamoyl]phenyl]propanamide.
| Compound Name | N-[3-methyl-4-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methylsulfamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 90612721 |
| Molecular Formula | C20H20N2O4S3 |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | N-[3-methyl-4-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methylsulfamoyl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(S(=O)(=O)NCc2ccc(C(=O)c3ccsc3)s2)c(C)c1 |
| InChI | InChI=1S/C20H20N2O4S3/c1-3-19(23)22-15-4-7-18(13(2)10-15)29(25,26)21-11-16-5-6-17(28-16)20(24)14-8-9-27-12-14/h4-10,12,21H,3,11H2,1-2H3,(H,22,23) |
| InChIKey | TUOZNVSVOPFGOM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |