C18H17NO4S3 — CID 90612682
4-methoxy-2-methyl-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]benzenesulfonamide (PubChem CID 90612682) has the molecular formula C18H17NO4S3 and a molecular weight of 407.54 g/mol. Its IUPAC name is 4-methoxy-2-methyl-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]benzenesulfonamide.
| Compound Name | 4-methoxy-2-methyl-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90612682 |
| Molecular Formula | C18H17NO4S3 |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 4-methoxy-2-methyl-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2ccc(C(=O)c3ccsc3)s2)c(C)c1 |
| InChI | InChI=1S/C18H17NO4S3/c1-12-9-14(23-2)3-6-17(12)26(21,22)19-10-15-4-5-16(25-15)18(20)13-7-8-24-11-13/h3-9,11,19H,10H2,1-2H3 |
| InChIKey | MHQLWCDGXLMLTJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |