C18H17NO3S3 — CID 90612653
4-ethyl-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]benzenesulfonamide (PubChem CID 90612653) has the molecular formula C18H17NO3S3 and a molecular weight of 391.54 g/mol. Its IUPAC name is 4-ethyl-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]benzenesulfonamide.
| Compound Name | 4-ethyl-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90612653 |
| Molecular Formula | C18H17NO3S3 |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 4-ethyl-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCc2ccc(C(=O)c3ccsc3)s2)cc1 |
| InChI | InChI=1S/C18H17NO3S3/c1-2-13-3-6-16(7-4-13)25(21,22)19-11-15-5-8-17(24-15)18(20)14-9-10-23-12-14/h3-10,12,19H,2,11H2,1H3 |
| InChIKey | ZPDAINIJBQGDNA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |