C16H12ClNO4S2 — CID 90612294
4-chloro-N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]benzenesulfonamide (PubChem CID 90612294) has the molecular formula C16H12ClNO4S2 and a molecular weight of 381.86 g/mol. Its IUPAC name is 4-chloro-N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90612294 |
| Molecular Formula | C16H12ClNO4S2 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | 4-chloro-N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]benzenesulfonamide |
| SMILES | O=C(c1ccco1)c1ccc(CNS(=O)(=O)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C16H12ClNO4S2/c17-11-3-6-13(7-4-11)24(20,21)18-10-12-5-8-15(23-12)16(19)14-2-1-9-22-14/h1-9,18H,10H2 |
| InChIKey | VLDJXNCVGNJGSN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |