C11H12BrNO2S — CID 72716721
[5-(2-aminoethyl)thiophen-2-yl]-(furan-2-yl)methanone;hydrobromide (PubChem CID 72716721) has the molecular formula C11H12BrNO2S and a molecular weight of 302.19 g/mol. Its IUPAC name is [5-(2-aminoethyl)thiophen-2-yl]-(furan-2-yl)methanone;hydrobromide.
| Compound Name | [5-(2-aminoethyl)thiophen-2-yl]-(furan-2-yl)methanone;hydrobromide |
|---|---|
| PubChem CID | 72716721 |
| Molecular Formula | C11H12BrNO2S |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | [5-(2-aminoethyl)thiophen-2-yl]-(furan-2-yl)methanone;hydrobromide |
| SMILES | Br.NCCc1ccc(C(=O)c2ccco2)s1 |
| InChI | InChI=1S/C11H11NO2S.BrH/c12-6-5-8-3-4-10(15-8)11(13)9-2-1-7-14-9;/h1-4,7H,5-6,12H2;1H |
| InChIKey | KLVDRZUJFQWJPG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |