C15H11N3O3S — CID 90612104
N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]pyrazine-2-carboxamide (PubChem CID 90612104) has the molecular formula C15H11N3O3S and a molecular weight of 313.34 g/mol. Its IUPAC name is N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]pyrazine-2-carboxamide.
| Compound Name | N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 90612104 |
| Molecular Formula | C15H11N3O3S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]pyrazine-2-carboxamide |
| SMILES | O=C(NCc1ccc(C(=O)c2ccco2)s1)c1cnccn1 |
| InChI | InChI=1S/C15H11N3O3S/c19-14(12-2-1-7-21-12)13-4-3-10(22-13)8-18-15(20)11-9-16-5-6-17-11/h1-7,9H,8H2,(H,18,20) |
| InChIKey | ZDHYPDYIQDJRDD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |