C17H11F2NO3S — CID 72717493
2,6-difluoro-N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]benzamide (PubChem CID 72717493) has the molecular formula C17H11F2NO3S and a molecular weight of 347.34 g/mol. Its IUPAC name is 2,6-difluoro-N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]benzamide.
| Compound Name | 2,6-difluoro-N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 72717493 |
| Molecular Formula | C17H11F2NO3S |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 2,6-difluoro-N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]benzamide |
| SMILES | O=C(c1ccco1)c1ccc(CNC(=O)c2c(F)cccc2F)s1 |
| InChI | InChI=1S/C17H11F2NO3S/c18-11-3-1-4-12(19)15(11)17(22)20-9-10-6-7-14(24-10)16(21)13-5-2-8-23-13/h1-8H,9H2,(H,20,22) |
| InChIKey | ZFYQBJROVLSJJF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |