C18H12F3NO3S — CID 90612194
N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]-4-(trifluoromethyl)benzamide (PubChem CID 90612194) has the molecular formula C18H12F3NO3S and a molecular weight of 379.36 g/mol. Its IUPAC name is N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 90612194 |
| Molecular Formula | C18H12F3NO3S |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NCc1ccc(C(=O)c2ccco2)s1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H12F3NO3S/c19-18(20,21)12-5-3-11(4-6-12)17(24)22-10-13-7-8-15(26-13)16(23)14-2-1-9-25-14/h1-9H,10H2,(H,22,24) |
| InChIKey | CTQJJGSVOSDKLP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |