C20H15F3N2O2S — CID 90613181
1-[(5-benzoylthiophen-2-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 90613181) has the molecular formula C20H15F3N2O2S and a molecular weight of 404.41 g/mol. Its IUPAC name is 1-[(5-benzoylthiophen-2-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(5-benzoylthiophen-2-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 90613181 |
| Molecular Formula | C20H15F3N2O2S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 1-[(5-benzoylthiophen-2-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCc1ccc(C(=O)c2ccccc2)s1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H15F3N2O2S/c21-20(22,23)14-6-8-15(9-7-14)25-19(27)24-12-16-10-11-17(28-16)18(26)13-4-2-1-3-5-13/h1-11H,12H2,(H2,24,25,27) |
| InChIKey | DKEPAIWGWAIXNY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |