About 1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea
1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 86986978) has the molecular formula C17H14F3N5O
and a molecular weight of 361.33 g/mol. Its IUPAC name is 1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea.
Molecular Properties
| Compound Name | 1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea |
| PubChem CID | 86986978 |
| Molecular Formula | C17H14F3N5O |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCc1nncn1-c1ccccc1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F3N5O/c18-17(19,20)12-6-8-13(9-7-12)23-16(26)21-10-15-24-22-11-25(15)14-4-2-1-3-5-14/h1-9,11H,10H2,(H2,21,23,26) |
| InChIKey | ZNYQNWHANQOSRN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea?
The IUPAC name of 1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea (CID 86986978) is 1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea.
What is the SMILES notation for 1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea?
The canonical SMILES for 1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea is O=C(NCc1nncn1-c1ccccc1)Nc1ccc(C(F)(F)F)cc1.
What is the InChIKey of 1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea?
The InChIKey is ZNYQNWHANQOSRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F3N5O/c18-17(19,20)12-6-8-13(9-7-12)23-16(26)21-10-15-24-22-11-25(15)14-4-2-1-3-5-14/h1-9,11H,10H2,(H2,21,23,26).
What are the key properties of 1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea?
1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea has a molecular weight of 361.33 g/mol, XLogP of 3.61, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea is sourced from PubChem (CID 86986978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).