C21H20N2O6S2 — CID 90612252
N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]-4-morpholin-4-ylsulfonylbenzamide (PubChem CID 90612252) has the molecular formula C21H20N2O6S2 and a molecular weight of 460.53 g/mol. Its IUPAC name is N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]-4-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]-4-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 90612252 |
| Molecular Formula | C21H20N2O6S2 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]-4-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(NCc1ccc(C(=O)c2ccco2)s1)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H20N2O6S2/c24-20(18-2-1-11-29-18)19-8-5-16(30-19)14-22-21(25)15-3-6-17(7-4-15)31(26,27)23-9-12-28-13-10-23/h1-8,11H,9-10,12-14H2,(H,22,25) |
| InChIKey | GUPYXZZACVWPLS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |