C16H17BrN2O4S2 — CID 32775606
N-[(5-bromothiophen-2-yl)methyl]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 32775606) has the molecular formula C16H17BrN2O4S2 and a molecular weight of 445.36 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 32775606 |
| Molecular Formula | C16H17BrN2O4S2 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 443.98 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(NCc1ccc(Br)s1)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C16H17BrN2O4S2/c17-15-5-4-13(24-15)11-18-16(20)12-2-1-3-14(10-12)25(21,22)19-6-8-23-9-7-19/h1-5,10H,6-9,11H2,(H,18,20) |
| InChIKey | MLQPRFFWSIGHRM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |