C17H14ClNO5S2 — CID 90612336
5-chloro-N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]-2-methoxybenzenesulfonamide (PubChem CID 90612336) has the molecular formula C17H14ClNO5S2 and a molecular weight of 411.89 g/mol. Its IUPAC name is 5-chloro-N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-chloro-N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 90612336 |
| Molecular Formula | C17H14ClNO5S2 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | 5-chloro-N-[[5-(furan-2-carbonyl)thiophen-2-yl]methyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)NCc1ccc(C(=O)c2ccco2)s1 |
| InChI | InChI=1S/C17H14ClNO5S2/c1-23-13-6-4-11(18)9-16(13)26(21,22)19-10-12-5-7-15(25-12)17(20)14-3-2-8-24-14/h2-9,19H,10H2,1H3 |
| InChIKey | LDLLXBDOMIGOIR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |