C21H21NO4S2 — CID 90613047
N-[(5-benzoylthiophen-2-yl)methyl]-5-ethyl-2-methoxybenzenesulfonamide (PubChem CID 90613047) has the molecular formula C21H21NO4S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is N-[(5-benzoylthiophen-2-yl)methyl]-5-ethyl-2-methoxybenzenesulfonamide.
| Compound Name | N-[(5-benzoylthiophen-2-yl)methyl]-5-ethyl-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 90613047 |
| Molecular Formula | C21H21NO4S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N-[(5-benzoylthiophen-2-yl)methyl]-5-ethyl-2-methoxybenzenesulfonamide |
| SMILES | CCc1ccc(OC)c(S(=O)(=O)NCc2ccc(C(=O)c3ccccc3)s2)c1 |
| InChI | InChI=1S/C21H21NO4S2/c1-3-15-9-11-18(26-2)20(13-15)28(24,25)22-14-17-10-12-19(27-17)21(23)16-7-5-4-6-8-16/h4-13,22H,3,14H2,1-2H3 |
| InChIKey | FJYDPWFPALIUIH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |