C17H14FNO3S3 — CID 90612662
1-(4-fluorophenyl)-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]methanesulfonamide (PubChem CID 90612662) has the molecular formula C17H14FNO3S3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]methanesulfonamide.
| Compound Name | 1-(4-fluorophenyl)-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 90612662 |
| Molecular Formula | C17H14FNO3S3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]methanesulfonamide |
| SMILES | O=C(c1ccsc1)c1ccc(CNS(=O)(=O)Cc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C17H14FNO3S3/c18-14-3-1-12(2-4-14)11-25(21,22)19-9-15-5-6-16(24-15)17(20)13-7-8-23-10-13/h1-8,10,19H,9,11H2 |
| InChIKey | TYRKJEQLCXKCMI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |