C15H21N3O — CID 90653128
(2S)-2-amino-N-(1H-indol-2-ylmethyl)-3,3-dimethylbutanamide (PubChem CID 90653128) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is (2S)-2-amino-N-(1H-indol-2-ylmethyl)-3,3-dimethylbutanamide.
| Compound Name | (2S)-2-amino-N-(1H-indol-2-ylmethyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 90653128 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | (2S)-2-amino-N-(1H-indol-2-ylmethyl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)[C@H](N)C(=O)NCc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H21N3O/c1-15(2,3)13(16)14(19)17-9-11-8-10-6-4-5-7-12(10)18-11/h4-8,13,18H,9,16H2,1-3H3,(H,17,19)/t13-/m1/s1 |
| InChIKey | IGKAZVPAXNFTIW-CYBMUJFWSA-N |
| XLogP | 2.16 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |