About 1-[(4-cyanophenyl)methyl]-3-(2-hydroxy-2,5-dimethylhexyl)urea
1-[(4-cyanophenyl)methyl]-3-(2-hydroxy-2,5-dimethylhexyl)urea (PubChem CID 111454376) has the molecular formula C17H25N3O2
and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-[(4-cyanophenyl)methyl]-3-(2-hydroxy-2,5-dimethylhexyl)urea.
Molecular Properties
| Compound Name | 1-[(4-cyanophenyl)methyl]-3-(2-hydroxy-2,5-dimethylhexyl)urea |
| PubChem CID | 111454376 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 1-[(4-cyanophenyl)methyl]-3-(2-hydroxy-2,5-dimethylhexyl)urea |
| SMILES | CC(C)CCC(C)(O)CNC(=O)NCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H25N3O2/c1-13(2)8-9-17(3,22)12-20-16(21)19-11-15-6-4-14(10-18)5-7-15/h4-7,13,22H,8-9,11-12H2,1-3H3,(H2,19,20,21) |
| InChIKey | TVOVYEQSCKUOTN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(4-cyanophenyl)methyl]-3-(2-hydroxy-2,5-dimethylhexyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-cyanophenyl)methyl]-3-(2-hydroxy-2,5-dimethylhexyl)urea?
The IUPAC name of 1-[(4-cyanophenyl)methyl]-3-(2-hydroxy-2,5-dimethylhexyl)urea (CID 111454376) is 1-[(4-cyanophenyl)methyl]-3-(2-hydroxy-2,5-dimethylhexyl)urea.
What is the SMILES notation for 1-[(4-cyanophenyl)methyl]-3-(2-hydroxy-2,5-dimethylhexyl)urea?
The canonical SMILES for 1-[(4-cyanophenyl)methyl]-3-(2-hydroxy-2,5-dimethylhexyl)urea is CC(C)CCC(C)(O)CNC(=O)NCc1ccc(C#N)cc1.
What is the InChIKey of 1-[(4-cyanophenyl)methyl]-3-(2-hydroxy-2,5-dimethylhexyl)urea?
The InChIKey is TVOVYEQSCKUOTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N3O2/c1-13(2)8-9-17(3,22)12-20-16(21)19-11-15-6-4-14(10-18)5-7-15/h4-7,13,22H,8-9,11-12H2,1-3H3,(H2,19,20,21).
What are the key properties of 1-[(4-cyanophenyl)methyl]-3-(2-hydroxy-2,5-dimethylhexyl)urea?
1-[(4-cyanophenyl)methyl]-3-(2-hydroxy-2,5-dimethylhexyl)urea has a molecular weight of 303.41 g/mol, XLogP of 2.54, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-cyanophenyl)methyl]-3-(2-hydroxy-2,5-dimethylhexyl)urea is sourced from PubChem (CID 111454376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).