C17H25N3O2 — CID 111454376
1-[(4-cyanophenyl)methyl]-3-(2-hydroxy-2,5-dimethylhexyl)urea (PubChem CID 111454376) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-[(4-cyanophenyl)methyl]-3-(2-hydroxy-2,5-dimethylhexyl)urea.
| Compound Name | 1-[(4-cyanophenyl)methyl]-3-(2-hydroxy-2,5-dimethylhexyl)urea |
|---|---|
| PubChem CID | 111454376 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 1-[(4-cyanophenyl)methyl]-3-(2-hydroxy-2,5-dimethylhexyl)urea |
| SMILES | CC(C)CCC(C)(O)CNC(=O)NCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H25N3O2/c1-13(2)8-9-17(3,22)12-20-16(21)19-11-15-6-4-14(10-18)5-7-15/h4-7,13,22H,8-9,11-12H2,1-3H3,(H2,19,20,21) |
| InChIKey | TVOVYEQSCKUOTN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |