About 1-benzyl-3-(2-hydroxy-2,5-dimethylhexyl)urea
1-benzyl-3-(2-hydroxy-2,5-dimethylhexyl)urea (PubChem CID 111450167) has the molecular formula C16H26N2O2
and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-benzyl-3-(2-hydroxy-2,5-dimethylhexyl)urea.
Molecular Properties
| Compound Name | 1-benzyl-3-(2-hydroxy-2,5-dimethylhexyl)urea |
| PubChem CID | 111450167 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 1-benzyl-3-(2-hydroxy-2,5-dimethylhexyl)urea |
| SMILES | CC(C)CCC(C)(O)CNC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C16H26N2O2/c1-13(2)9-10-16(3,20)12-18-15(19)17-11-14-7-5-4-6-8-14/h4-8,13,20H,9-12H2,1-3H3,(H2,17,18,19) |
| InChIKey | MSBYEGXFDXFSPS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-3-(2-hydroxy-2,5-dimethylhexyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-(2-hydroxy-2,5-dimethylhexyl)urea?
The IUPAC name of 1-benzyl-3-(2-hydroxy-2,5-dimethylhexyl)urea (CID 111450167) is 1-benzyl-3-(2-hydroxy-2,5-dimethylhexyl)urea.
What is the SMILES notation for 1-benzyl-3-(2-hydroxy-2,5-dimethylhexyl)urea?
The canonical SMILES for 1-benzyl-3-(2-hydroxy-2,5-dimethylhexyl)urea is CC(C)CCC(C)(O)CNC(=O)NCc1ccccc1.
What is the InChIKey of 1-benzyl-3-(2-hydroxy-2,5-dimethylhexyl)urea?
The InChIKey is MSBYEGXFDXFSPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O2/c1-13(2)9-10-16(3,20)12-18-15(19)17-11-14-7-5-4-6-8-14/h4-8,13,20H,9-12H2,1-3H3,(H2,17,18,19).
What are the key properties of 1-benzyl-3-(2-hydroxy-2,5-dimethylhexyl)urea?
1-benzyl-3-(2-hydroxy-2,5-dimethylhexyl)urea has a molecular weight of 278.40 g/mol, XLogP of 2.67, 7 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-(2-hydroxy-2,5-dimethylhexyl)urea is sourced from PubChem (CID 111450167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).