C17H25FN2O3 — CID 71989683
5-acetamido-2-fluoro-N-(2-hydroxy-2,5-dimethylhexyl)benzamide (PubChem CID 71989683) has the molecular formula C17H25FN2O3 and a molecular weight of 324.40 g/mol. Its IUPAC name is 5-acetamido-2-fluoro-N-(2-hydroxy-2,5-dimethylhexyl)benzamide.
| Compound Name | 5-acetamido-2-fluoro-N-(2-hydroxy-2,5-dimethylhexyl)benzamide |
|---|---|
| PubChem CID | 71989683 |
| Molecular Formula | C17H25FN2O3 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 5-acetamido-2-fluoro-N-(2-hydroxy-2,5-dimethylhexyl)benzamide |
| SMILES | CC(=O)Nc1ccc(F)c(C(=O)NCC(C)(O)CCC(C)C)c1 |
| InChI | InChI=1S/C17H25FN2O3/c1-11(2)7-8-17(4,23)10-19-16(22)14-9-13(20-12(3)21)5-6-15(14)18/h5-6,9,11,23H,7-8,10H2,1-4H3,(H,19,22)(H,20,21) |
| InChIKey | KZSVHEXQBDPWCK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |