C16H18N2O5S — CID 4241240
3,5-dimethoxy-4-methyl-N-(3-sulfamoylphenyl)benzamide (PubChem CID 4241240) has the molecular formula C16H18N2O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is 3,5-dimethoxy-4-methyl-N-(3-sulfamoylphenyl)benzamide.
| Compound Name | 3,5-dimethoxy-4-methyl-N-(3-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 4241240 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 3,5-dimethoxy-4-methyl-N-(3-sulfamoylphenyl)benzamide |
| SMILES | COc1cc(C(=O)Nc2cccc(S(N)(=O)=O)c2)cc(OC)c1C |
| InChI | InChI=1S/C16H18N2O5S/c1-10-14(22-2)7-11(8-15(10)23-3)16(19)18-12-5-4-6-13(9-12)24(17,20)21/h4-9H,1-3H3,(H,18,19)(H2,17,20,21) |
| InChIKey | OADVNXJOERWXAJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |