C11H15N3O6S — CID 107825750
(2S)-4-hydroxy-2-[(3-sulfamoylphenyl)carbamoylamino]butanoic acid (PubChem CID 107825750) has the molecular formula C11H15N3O6S and a molecular weight of 317.32 g/mol. Its IUPAC name is (2S)-4-hydroxy-2-[(3-sulfamoylphenyl)carbamoylamino]butanoic acid.
| Compound Name | (2S)-4-hydroxy-2-[(3-sulfamoylphenyl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 107825750 |
| Molecular Formula | C11H15N3O6S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | (2S)-4-hydroxy-2-[(3-sulfamoylphenyl)carbamoylamino]butanoic acid |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)N[C@@H](CCO)C(=O)O)c1 |
| InChI | InChI=1S/C11H15N3O6S/c12-21(19,20)8-3-1-2-7(6-8)13-11(18)14-9(4-5-15)10(16)17/h1-3,6,9,15H,4-5H2,(H,16,17)(H2,12,19,20)(H2,13,14,18)/t9-/m0/s1 |
| InChIKey | DFSZSMJUQULNNM-VIFPVBQESA-N |
| XLogP | -0.71 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |