C14H21N3O4S2 — CID 8620380
methyl 6-[(3-sulfamoylphenyl)carbamothioylamino]hexanoate (PubChem CID 8620380) has the molecular formula C14H21N3O4S2 and a molecular weight of 359.47 g/mol. Its IUPAC name is methyl 6-[(3-sulfamoylphenyl)carbamothioylamino]hexanoate.
| Compound Name | methyl 6-[(3-sulfamoylphenyl)carbamothioylamino]hexanoate |
|---|---|
| PubChem CID | 8620380 |
| Molecular Formula | C14H21N3O4S2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | methyl 6-[(3-sulfamoylphenyl)carbamothioylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=S)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C14H21N3O4S2/c1-21-13(18)8-3-2-4-9-16-14(22)17-11-6-5-7-12(10-11)23(15,19)20/h5-7,10H,2-4,8-9H2,1H3,(H2,15,19,20)(H2,16,17,22) |
| InChIKey | KSCHIKVXMXBKSH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|