C26H30N4O4S — CID 10228454
2-(3-carbamimidoylphenoxy)-N-[4-(2-sulfamoylphenyl)phenyl]heptanamide (PubChem CID 10228454) has the molecular formula C26H30N4O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is 2-(3-carbamimidoylphenoxy)-N-[4-(2-sulfamoylphenyl)phenyl]heptanamide.
| Compound Name | 2-(3-carbamimidoylphenoxy)-N-[4-(2-sulfamoylphenyl)phenyl]heptanamide |
|---|---|
| PubChem CID | 10228454 |
| Molecular Formula | C26H30N4O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 2-(3-carbamimidoylphenoxy)-N-[4-(2-sulfamoylphenyl)phenyl]heptanamide |
| SMILES | [H]/N=C(\N)c1cccc(OC(CCCCC)C(=O)Nc2ccc(-c3ccccc3S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C26H30N4O4S/c1-2-3-4-11-23(34-21-9-7-8-19(17-21)25(27)28)26(31)30-20-15-13-18(14-16-20)22-10-5-6-12-24(22)35(29,32)33/h5-10,12-17,23H,2-4,11H2,1H3,(H3,27,28)(H,30,31)(H2,29,32,33) |
| InChIKey | NDAJUSKXOVVTCC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 148.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|