C23H19F3N4O3S — CID 54421193
3-(3-carbamimidoylphenyl)-4,4,4-trifluoro-N-[4-(2-sulfamoylphenyl)phenyl]but-2-enamide (PubChem CID 54421193) has the molecular formula C23H19F3N4O3S and a molecular weight of 488.49 g/mol. Its IUPAC name is 3-(3-carbamimidoylphenyl)-4,4,4-trifluoro-N-[4-(2-sulfamoylphenyl)phenyl]but-2-enamide.
| Compound Name | 3-(3-carbamimidoylphenyl)-4,4,4-trifluoro-N-[4-(2-sulfamoylphenyl)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 54421193 |
| Molecular Formula | C23H19F3N4O3S |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 3-(3-carbamimidoylphenyl)-4,4,4-trifluoro-N-[4-(2-sulfamoylphenyl)phenyl]but-2-enamide |
| SMILES | [H]/N=C(\N)c1cccc(C(=CC(=O)Nc2ccc(-c3ccccc3S(N)(=O)=O)cc2)C(F)(F)F)c1 |
| InChI | InChI=1S/C23H19F3N4O3S/c24-23(25,26)19(15-4-3-5-16(12-15)22(27)28)13-21(31)30-17-10-8-14(9-11-17)18-6-1-2-7-20(18)34(29,32)33/h1-13H,(H3,27,28)(H,30,31)(H2,29,32,33) |
| InChIKey | WAXJHHIORWYCRK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 139.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|