C26H27N6O3S+ — CID 142012231
[(E)-2-(3-carbamimidoylphenyl)-4-oxo-4-[4-(2-sulfamoylphenyl)anilino]but-2-enyl]-[(Z)-3-iminoprop-1-enyl]azanium (PubChem CID 142012231) has the molecular formula C26H27N6O3S+ and a molecular weight of 503.61 g/mol. Its IUPAC name is [(E)-2-(3-carbamimidoylphenyl)-4-oxo-4-[4-(2-sulfamoylphenyl)anilino]but-2-enyl]-[(Z)-3-iminoprop-1-enyl]azanium.
| Compound Name | [(E)-2-(3-carbamimidoylphenyl)-4-oxo-4-[4-(2-sulfamoylphenyl)anilino]but-2-enyl]-[(Z)-3-iminoprop-1-enyl]azanium |
|---|---|
| PubChem CID | 142012231 |
| Molecular Formula | C26H27N6O3S+ |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | [(E)-2-(3-carbamimidoylphenyl)-4-oxo-4-[4-(2-sulfamoylphenyl)anilino]but-2-enyl]-[(Z)-3-iminoprop-1-enyl]azanium |
| SMILES | [H]/N=C(\N)c1cccc(/C(=C\C(=O)Nc2ccc(-c3ccccc3S(N)(=O)=O)cc2)C[NH2+]/C=C\C=N\[H])c1 |
| InChI | InChI=1S/C26H26N6O3S/c27-13-4-14-31-17-21(19-5-3-6-20(15-19)26(28)29)16-25(33)32-22-11-9-18(10-12-22)23-7-1-2-8-24(23)36(30,34)35/h1-16,27,31H,17H2,(H3,28,29)(H,32,33)(H2,30,34,35)/p+1/b14-4-,21-16-,27-13+ |
| InChIKey | FERIXOMZCILGGD-NNPKKGCJSA-O |
| XLogP | 2.03 |
| TPSA | 179.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|