C25H27N5O4S2 — CID 157107198
4-(3-carbamimidoylanilino)sulfanyl-N-[4-(2-sulfamoylphenyl)phenyl]oxane-4-carboxamide (PubChem CID 157107198) has the molecular formula C25H27N5O4S2 and a molecular weight of 525.66 g/mol. Its IUPAC name is 4-(3-carbamimidoylanilino)sulfanyl-N-[4-(2-sulfamoylphenyl)phenyl]oxane-4-carboxamide.
| Compound Name | 4-(3-carbamimidoylanilino)sulfanyl-N-[4-(2-sulfamoylphenyl)phenyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 157107198 |
| Molecular Formula | C25H27N5O4S2 |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | 4-(3-carbamimidoylanilino)sulfanyl-N-[4-(2-sulfamoylphenyl)phenyl]oxane-4-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(NSC2(C(=O)Nc3ccc(-c4ccccc4S(N)(=O)=O)cc3)CCOCC2)c1 |
| InChI | InChI=1S/C25H27N5O4S2/c26-23(27)18-4-3-5-20(16-18)30-35-25(12-14-34-15-13-25)24(31)29-19-10-8-17(9-11-19)21-6-1-2-7-22(21)36(28,32)33/h1-11,16,30H,12-15H2,(H3,26,27)(H,29,31)(H2,28,32,33) |
| InChIKey | SSYCYKZMVBSJMR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 160.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|