C25H27N5O5S — CID 91127799
4-[3-(N'-hydroxycarbamimidoyl)anilino]-N-[4-(2-sulfamoylphenyl)phenyl]oxane-4-carboxamide (PubChem CID 91127799) has the molecular formula C25H27N5O5S and a molecular weight of 509.59 g/mol. Its IUPAC name is 4-[3-(N'-hydroxycarbamimidoyl)anilino]-N-[4-(2-sulfamoylphenyl)phenyl]oxane-4-carboxamide.
| Compound Name | 4-[3-(N'-hydroxycarbamimidoyl)anilino]-N-[4-(2-sulfamoylphenyl)phenyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 91127799 |
| Molecular Formula | C25H27N5O5S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | 4-[3-(N'-hydroxycarbamimidoyl)anilino]-N-[4-(2-sulfamoylphenyl)phenyl]oxane-4-carboxamide |
| SMILES | NC(=NO)c1cccc(NC2(C(=O)Nc3ccc(-c4ccccc4S(N)(=O)=O)cc3)CCOCC2)c1 |
| InChI | InChI=1S/C25H27N5O5S/c26-23(30-32)18-4-3-5-20(16-18)29-25(12-14-35-15-13-25)24(31)28-19-10-8-17(9-11-19)21-6-1-2-7-22(21)36(27,33)34/h1-11,16,29,32H,12-15H2,(H2,26,30)(H,28,31)(H2,27,33,34) |
| InChIKey | SFXNHHPBGOLXKG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 169.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|