C23H22N4O4S — CID 91094095
2-[3-(N'-hydroxycarbamimidoyl)phenyl]-1-[4-(2-sulfamoylphenyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 91094095) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is 2-[3-(N'-hydroxycarbamimidoyl)phenyl]-1-[4-(2-sulfamoylphenyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | 2-[3-(N'-hydroxycarbamimidoyl)phenyl]-1-[4-(2-sulfamoylphenyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 91094095 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 2-[3-(N'-hydroxycarbamimidoyl)phenyl]-1-[4-(2-sulfamoylphenyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | NC(=O)C1(c2ccc(-c3ccccc3S(N)(=O)=O)cc2)CC1c1cccc(C(N)=NO)c1 |
| InChI | InChI=1S/C23H22N4O4S/c24-21(27-29)16-5-3-4-15(12-16)19-13-23(19,22(25)28)17-10-8-14(9-11-17)18-6-1-2-7-20(18)32(26,30)31/h1-12,19,29H,13H2,(H2,24,27)(H2,25,28)(H2,26,30,31) |
| InChIKey | ZQRAYHWUZXCHQI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 161.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|