C24H23N3O4S — CID 90894712
2-[3-(N'-hydroxycarbamimidoyl)phenyl]-1-[4-(2-methylsulfonylphenyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 90894712) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is 2-[3-(N'-hydroxycarbamimidoyl)phenyl]-1-[4-(2-methylsulfonylphenyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | 2-[3-(N'-hydroxycarbamimidoyl)phenyl]-1-[4-(2-methylsulfonylphenyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 90894712 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 2-[3-(N'-hydroxycarbamimidoyl)phenyl]-1-[4-(2-methylsulfonylphenyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | CS(=O)(=O)c1ccccc1-c1ccc(C2(C(N)=O)CC2c2cccc(C(N)=NO)c2)cc1 |
| InChI | InChI=1S/C24H23N3O4S/c1-32(30,31)21-8-3-2-7-19(21)15-9-11-18(12-10-15)24(23(26)28)14-20(24)16-5-4-6-17(13-16)22(25)27-29/h2-13,20,29H,14H2,1H3,(H2,25,27)(H2,26,28) |
| InChIKey | MKBWIEAYZCHTDN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|