C26H27F3N4O6S — CID 173237958
2-[3-(N'-hydroxycarbamimidoyl)anilino]-2-methyl-N-[4-(2-methylsulfonylphenyl)phenyl]propanamide;2,2,2-trifluoroacetic acid (PubChem CID 173237958) has the molecular formula C26H27F3N4O6S and a molecular weight of 580.59 g/mol. Its IUPAC name is 2-[3-(N'-hydroxycarbamimidoyl)anilino]-2-methyl-N-[4-(2-methylsulfonylphenyl)phenyl]propanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[3-(N'-hydroxycarbamimidoyl)anilino]-2-methyl-N-[4-(2-methylsulfonylphenyl)phenyl]propanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 173237958 |
| Molecular Formula | C26H27F3N4O6S |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | 2-[3-(N'-hydroxycarbamimidoyl)anilino]-2-methyl-N-[4-(2-methylsulfonylphenyl)phenyl]propanamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)(Nc1cccc(C(N)=NO)c1)C(=O)Nc1ccc(-c2ccccc2S(C)(=O)=O)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H26N4O4S.C2HF3O2/c1-24(2,27-19-8-6-7-17(15-19)22(25)28-30)23(29)26-18-13-11-16(12-14-18)20-9-4-5-10-21(20)33(3,31)32;3-2(4,5)1(6)7/h4-15,27,30H,1-3H3,(H2,25,28)(H,26,29);(H,6,7) |
| InChIKey | ROQRWWBNQSZLKK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 171.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|