C27H25F4N5O6S — CID 10211278
N-[4-(2-cyano-3-fluorophenyl)phenyl]-3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-[methyl(methylsulfonyl)amino]propanamide;2,2,2-trifluoroacetic acid (PubChem CID 10211278) has the molecular formula C27H25F4N5O6S and a molecular weight of 623.59 g/mol. Its IUPAC name is N-[4-(2-cyano-3-fluorophenyl)phenyl]-3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-[methyl(methylsulfonyl)amino]propanamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[4-(2-cyano-3-fluorophenyl)phenyl]-3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-[methyl(methylsulfonyl)amino]propanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 10211278 |
| Molecular Formula | C27H25F4N5O6S |
| Molecular Weight | 623.59 g/mol |
| Exact Mass | 623.15 |
| IUPAC Name | N-[4-(2-cyano-3-fluorophenyl)phenyl]-3-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-[methyl(methylsulfonyl)amino]propanamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C(Cc1cccc(/C(N)=N/O)c1)C(=O)Nc1ccc(-c2cccc(F)c2C#N)cc1)S(C)(=O)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H24FN5O4S.C2HF3O2/c1-31(36(2,34)35)23(14-16-5-3-6-18(13-16)24(28)30-33)25(32)29-19-11-9-17(10-12-19)20-7-4-8-22(26)21(20)15-27;3-2(4,5)1(6)7/h3-13,23,33H,14H2,1-2H3,(H2,28,30)(H,29,32);(H,6,7) |
| InChIKey | YDAFYITYTWOJJX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 186.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.59 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|