C27H29FN4O5S — CID 90959665
N-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]-N'-[[3-(N'-hydroxycarbamimidoyl)phenyl]methyl]-N'-(2-methylpropyl)oxamide (PubChem CID 90959665) has the molecular formula C27H29FN4O5S and a molecular weight of 540.62 g/mol. Its IUPAC name is N-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]-N'-[[3-(N'-hydroxycarbamimidoyl)phenyl]methyl]-N'-(2-methylpropyl)oxamide.
| Compound Name | N-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]-N'-[[3-(N'-hydroxycarbamimidoyl)phenyl]methyl]-N'-(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 90959665 |
| Molecular Formula | C27H29FN4O5S |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | N-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]-N'-[[3-(N'-hydroxycarbamimidoyl)phenyl]methyl]-N'-(2-methylpropyl)oxamide |
| SMILES | CC(C)CN(Cc1cccc(C(N)=NO)c1)C(=O)C(=O)Nc1ccc(-c2ccccc2S(C)(=O)=O)cc1F |
| InChI | InChI=1S/C27H29FN4O5S/c1-17(2)15-32(16-18-7-6-8-20(13-18)25(29)31-35)27(34)26(33)30-23-12-11-19(14-22(23)28)21-9-4-5-10-24(21)38(3,36)37/h4-14,17,35H,15-16H2,1-3H3,(H2,29,31)(H,30,33) |
| InChIKey | RBDLWHWGONUNOF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 142.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|