C28H29Cl3N4O5S — CID 10146088
2,2,2-trichloroethyl 3-[[2-methylpropyl-[2-oxo-2-[4-(2-sulfamoylphenyl)anilino]acetyl]amino]methyl]benzenecarboximidate (PubChem CID 10146088) has the molecular formula C28H29Cl3N4O5S and a molecular weight of 639.99 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 3-[[2-methylpropyl-[2-oxo-2-[4-(2-sulfamoylphenyl)anilino]acetyl]amino]methyl]benzenecarboximidate.
| Compound Name | 2,2,2-trichloroethyl 3-[[2-methylpropyl-[2-oxo-2-[4-(2-sulfamoylphenyl)anilino]acetyl]amino]methyl]benzenecarboximidate |
|---|---|
| PubChem CID | 10146088 |
| Molecular Formula | C28H29Cl3N4O5S |
| Molecular Weight | 639.99 g/mol |
| Exact Mass | 638.09 |
| IUPAC Name | 2,2,2-trichloroethyl 3-[[2-methylpropyl-[2-oxo-2-[4-(2-sulfamoylphenyl)anilino]acetyl]amino]methyl]benzenecarboximidate |
| SMILES | [H]/N=C(\OCC(Cl)(Cl)Cl)c1cccc(CN(CC(C)C)C(=O)C(=O)Nc2ccc(-c3ccccc3S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C28H29Cl3N4O5S/c1-18(2)15-35(16-19-6-5-7-21(14-19)25(32)40-17-28(29,30)31)27(37)26(36)34-22-12-10-20(11-13-22)23-8-3-4-9-24(23)41(33,38)39/h3-14,18,32H,15-17H2,1-2H3,(H,34,36)(H2,33,38,39)/b32-25- |
| InChIKey | NDCKSJDYVUYSBW-MKCFTUBBSA-N |
| XLogP | 5.34 |
| TPSA | 142.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.99 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|