C27H27Cl3N4O5S — CID 173237402
2,2,2-trichloroethyl N-[3-[[ethyl-[2-[4-(2-sulfamoylphenyl)phenyl]acetyl]amino]methyl]benzenecarboximidoyl]carbamate (PubChem CID 173237402) has the molecular formula C27H27Cl3N4O5S and a molecular weight of 625.96 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[3-[[ethyl-[2-[4-(2-sulfamoylphenyl)phenyl]acetyl]amino]methyl]benzenecarboximidoyl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[3-[[ethyl-[2-[4-(2-sulfamoylphenyl)phenyl]acetyl]amino]methyl]benzenecarboximidoyl]carbamate |
|---|---|
| PubChem CID | 173237402 |
| Molecular Formula | C27H27Cl3N4O5S |
| Molecular Weight | 625.96 g/mol |
| Exact Mass | 624.08 |
| IUPAC Name | 2,2,2-trichloroethyl N-[3-[[ethyl-[2-[4-(2-sulfamoylphenyl)phenyl]acetyl]amino]methyl]benzenecarboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OCC(Cl)(Cl)Cl)c1cccc(CN(CC)C(=O)Cc2ccc(-c3ccccc3S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C27H27Cl3N4O5S/c1-2-34(16-19-6-5-7-21(14-19)25(31)33-26(36)39-17-27(28,29)30)24(35)15-18-10-12-20(13-11-18)22-8-3-4-9-23(22)40(32,37)38/h3-14H,2,15-17H2,1H3,(H2,31,33,36)(H2,32,37,38) |
| InChIKey | IWJYYZVQTASJKP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 142.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.96 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|