C28H32N4O6S — CID 173238264
1-[3-(N-methoxycarbonylcarbamimidoyl)phenyl]hexan-2-yl-[4-(2-sulfamoylphenyl)phenyl]carbamic acid (PubChem CID 173238264) has the molecular formula C28H32N4O6S and a molecular weight of 552.65 g/mol. Its IUPAC name is 1-[3-(N-methoxycarbonylcarbamimidoyl)phenyl]hexan-2-yl-[4-(2-sulfamoylphenyl)phenyl]carbamic acid.
| Compound Name | 1-[3-(N-methoxycarbonylcarbamimidoyl)phenyl]hexan-2-yl-[4-(2-sulfamoylphenyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 173238264 |
| Molecular Formula | C28H32N4O6S |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 1-[3-(N-methoxycarbonylcarbamimidoyl)phenyl]hexan-2-yl-[4-(2-sulfamoylphenyl)phenyl]carbamic acid |
| SMILES | [H]/N=C(\NC(=O)OC)c1cccc(CC(CCCC)N(C(=O)O)c2ccc(-c3ccccc3S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C28H32N4O6S/c1-3-4-10-23(18-19-8-7-9-21(17-19)26(29)31-27(33)38-2)32(28(34)35)22-15-13-20(14-16-22)24-11-5-6-12-25(24)39(30,36)37/h5-9,11-17,23H,3-4,10,18H2,1-2H3,(H,34,35)(H2,29,31,33)(H2,30,36,37) |
| InChIKey | PWLHFXPIDJBWCE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 162.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|